C34H36P2 — CID 11352671
[(1S,2S,3S,5R)-3-diphenylphosphanyl-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diphenylphosphane (PubChem CID 11352671) has the molecular formula C34H36P2 and a molecular weight of 506.61 g/mol. Its IUPAC name is [(1S,2S,3S,5R)-3-diphenylphosphanyl-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diphenylphosphane.
| Compound Name | [(1S,2S,3S,5R)-3-diphenylphosphanyl-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diphenylphosphane |
|---|---|
| PubChem CID | 11352671 |
| Molecular Formula | C34H36P2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [(1S,2S,3S,5R)-3-diphenylphosphanyl-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methyl-diphenylphosphane |
| SMILES | CC1(C)[C@H]2C[C@H](P(c3ccccc3)c3ccccc3)[C@H](CP(c3ccccc3)c3ccccc3)[C@@H]1C2 |
| InChI | InChI=1S/C34H36P2/c1-34(2)26-23-32(34)31(25-35(27-15-7-3-8-16-27)28-17-9-4-10-18-28)33(24-26)36(29-19-11-5-12-20-29)30-21-13-6-14-22-30/h3-22,26,31-33H,23-25H2,1-2H3/t26-,31-,32+,33+/m1/s1 |
| InChIKey | PGECXHNUHRTXMH-FWXRQHCGSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|