C28H34O9 — CID 11352806
(4S,4aR,5aS,9Z,9aR,9bR)-2-[(E)-hex-4-enoyl]-1,4,4a,8-tetrahydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione (PubChem CID 11352806) has the molecular formula C28H34O9 and a molecular weight of 514.57 g/mol. Its IUPAC name is (4S,4aR,5aS,9Z,9aR,9bR)-2-[(E)-hex-4-enoyl]-1,4,4a,8-tetrahydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione.
| Compound Name | (4S,4aR,5aS,9Z,9aR,9bR)-2-[(E)-hex-4-enoyl]-1,4,4a,8-tetrahydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione |
|---|---|
| PubChem CID | 11352806 |
| Molecular Formula | C28H34O9 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (4S,4aR,5aS,9Z,9aR,9bR)-2-[(E)-hex-4-enoyl]-1,4,4a,8-tetrahydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione |
| SMILES | C/C=C/C=C/C(O)=C1/C(O)=C(C)C(=O)[C@@]2(C)O[C@@]3(O)[C@@](C)(O)C(=O)C(C(=O)CC/C=C/C)=C(O)[C@@]3(C)[C@@H]12 |
| InChI | InChI=1S/C28H34O9/c1-7-9-11-13-16(29)18-20(31)15(3)22(32)26(5)21(18)25(4)23(33)19(17(30)14-12-10-8-2)24(34)27(6,35)28(25,36)37-26/h7-11,13,21,29,31,33,35-36H,12,14H2,1-6H3/b9-7+,10-8+,13-11+,18-16+/t21-,25-,26+,27+,28-/m1/s1 |
| InChIKey | WQBJMULJHJGKBM-MSRGAVKGSA-N |
| XLogP | 3.52 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|