About tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane
tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane (PubChem CID 11352958) has the molecular formula C27H48O2Sn
and a molecular weight of 523.39 g/mol. Its IUPAC name is tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane.
Molecular Properties
| Compound Name | tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane |
| PubChem CID | 11352958 |
| Molecular Formula | C27H48O2Sn |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CO[C@]1(c2ccccc2)CCC[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C15H21O2.3C4H9.Sn/c1-12(2)14-10-7-11-15(16-3,17-14)13-8-5-4-6-9-13;3*1-3-4-2;/h4-6,8-9,12,14H,3,7,10-11H2,1-2H3;3*1,3-4H2,2H3;/t14-,15+;;;;/m0..../s1 |
| InChIKey | IXVSVDXLOZPSIO-VSDDYELYSA-N |
| XLogP | 8.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane?
The IUPAC name of tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane (CID 11352958) is tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane.
What is the SMILES notation for tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane?
The canonical SMILES for tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane is CCCC[Sn](CCCC)(CCCC)CO[C@]1(c2ccccc2)CCC[C@@H](C(C)C)O1.
What is the InChIKey of tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane?
The InChIKey is IXVSVDXLOZPSIO-VSDDYELYSA-N. The full InChI is InChI=1S/C15H21O2.3C4H9.Sn/c1-12(2)14-10-7-11-15(16-3,17-14)13-8-5-4-6-9-13;3*1-3-4-2;/h4-6,8-9,12,14H,3,7,10-11H2,1-2H3;3*1,3-4H2,2H3;/t14-,15+;;;;/m0..../s1.
What are the key properties of tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane?
tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane has a molecular weight of 523.39 g/mol, XLogP of 8.47, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[[(2S,6S)-2-phenyl-6-propan-2-yloxan-2-yl]oxymethyl]stannane is sourced from PubChem (CID 11352958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).