C21H51NO5Si5 — CID 11353184
trimethylsilyl (3R,4S,5R)-1-trimethylsilyl-3,4,5-tris(trimethylsilyloxy)piperidine-3-carboxylate (PubChem CID 11353184) has the molecular formula C21H51NO5Si5 and a molecular weight of 538.07 g/mol. Its IUPAC name is trimethylsilyl (3R,4S,5R)-1-trimethylsilyl-3,4,5-tris(trimethylsilyloxy)piperidine-3-carboxylate.
| Compound Name | trimethylsilyl (3R,4S,5R)-1-trimethylsilyl-3,4,5-tris(trimethylsilyloxy)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 11353184 |
| Molecular Formula | C21H51NO5Si5 |
| Molecular Weight | 538.07 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | trimethylsilyl (3R,4S,5R)-1-trimethylsilyl-3,4,5-tris(trimethylsilyloxy)piperidine-3-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)[C@@]1(O[Si](C)(C)C)CN([Si](C)(C)C)C[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H51NO5Si5/c1-28(2,3)22-16-18(24-29(4,5)6)19(25-30(7,8)9)21(17-22,27-32(13,14)15)20(23)26-31(10,11)12/h18-19H,16-17H2,1-15H3/t18-,19+,21-/m1/s1 |
| InChIKey | OVZMTSAIVSAFGU-SVFBPWRDSA-N |
| XLogP | 5.55 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.07 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|