C33H39NO6 — CID 11353302
(2S,3R)-N,N-diethyl-3-[(4S,5R)-5-[(1R)-1-hydroxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide (PubChem CID 11353302) has the molecular formula C33H39NO6 and a molecular weight of 545.68 g/mol. Its IUPAC name is (2S,3R)-N,N-diethyl-3-[(4S,5R)-5-[(1R)-1-hydroxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide.
| Compound Name | (2S,3R)-N,N-diethyl-3-[(4S,5R)-5-[(1R)-1-hydroxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 11353302 |
| Molecular Formula | C33H39NO6 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | (2S,3R)-N,N-diethyl-3-[(4S,5R)-5-[(1R)-1-hydroxy-2-trityloxyethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@H]1O[C@@H]1[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H39NO6/c1-5-34(6-2)31(36)30-28(38-30)29-27(39-32(3,4)40-29)26(35)22-37-33(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21,26-30,35H,5-6,22H2,1-4H3/t26-,27-,28-,29-,30+/m1/s1 |
| InChIKey | UFPDOKNENFGXMN-WYQCABFXSA-N |
| XLogP | 4.51 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|