C24H43IO2Si2 — CID 11353310
tert-butyl-[(E,2S,3R,4S)-6-iodo-2,4-dimethyl-1-phenylmethoxy-6-trimethylsilylhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 11353310) has the molecular formula C24H43IO2Si2 and a molecular weight of 546.68 g/mol. Its IUPAC name is tert-butyl-[(E,2S,3R,4S)-6-iodo-2,4-dimethyl-1-phenylmethoxy-6-trimethylsilylhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(E,2S,3R,4S)-6-iodo-2,4-dimethyl-1-phenylmethoxy-6-trimethylsilylhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11353310 |
| Molecular Formula | C24H43IO2Si2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | tert-butyl-[(E,2S,3R,4S)-6-iodo-2,4-dimethyl-1-phenylmethoxy-6-trimethylsilylhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | C[C@@H](/C=C(/I)[Si](C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C24H43IO2Si2/c1-19(16-22(25)28(6,7)8)23(27-29(9,10)24(3,4)5)20(2)17-26-18-21-14-12-11-13-15-21/h11-16,19-20,23H,17-18H2,1-10H3/b22-16-/t19-,20-,23+/m0/s1 |
| InChIKey | LRCWPNQSTVVTIW-IUYNOFEFSA-N |
| XLogP | 8.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|