C28H37O11P — CID 11353707
methyl (2S,3S,4aR,6R,8R,8aS)-8-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate (PubChem CID 11353707) has the molecular formula C28H37O11P and a molecular weight of 580.57 g/mol. Its IUPAC name is methyl (2S,3S,4aR,6R,8R,8aS)-8-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate.
| Compound Name | methyl (2S,3S,4aR,6R,8R,8aS)-8-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate |
|---|---|
| PubChem CID | 11353707 |
| Molecular Formula | C28H37O11P |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | methyl (2S,3S,4aR,6R,8R,8aS)-8-bis(phenylmethoxy)phosphoryloxy-6-hydroxy-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-benzo[b][1,4]dioxine-6-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2[C@H](OP(=O)(OCc2ccccc2)OCc2ccccc2)C1 |
| InChI | InChI=1S/C28H37O11P/c1-26(33-4)27(2,34-5)38-24-22(37-26)16-28(30,25(29)32-3)17-23(24)39-40(31,35-18-20-12-8-6-9-13-20)36-19-21-14-10-7-11-15-21/h6-15,22-24,30H,16-19H2,1-5H3/t22-,23-,24+,26+,27+,28-/m1/s1 |
| InChIKey | QQKWHTAJTCZYGB-OGGSFHMSSA-N |
| XLogP | 4.12 |
| TPSA | 128.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|