C23H33Cl3N4O6Si — CID 11353857
[(2R,3S,4R,5R)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate (PubChem CID 11353857) has the molecular formula C23H33Cl3N4O6Si and a molecular weight of 595.98 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11353857 |
| Molecular Formula | C23H33Cl3N4O6Si |
| Molecular Weight | 595.98 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-azido-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl acetate |
| SMILES | [H]/N=C(/OC1O[C@H](COC(C)=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H33Cl3N4O6Si/c1-14(31)32-13-16-18(36-37(5,6)22(2,3)4)19(33-12-15-10-8-7-9-11-15)17(29-30-28)20(34-16)35-21(27)23(24,25)26/h7-11,16-20,27H,12-13H2,1-6H3/b27-21+/t16-,17-,18-,19-,20?/m1/s1 |
| InChIKey | IGZILOSORITVLF-XAEXJQTDSA-N |
| XLogP | 6.29 |
| TPSA | 135.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.98 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|