C37H49N3O5 — CID 11354028
ethyl 2-benzyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-7-hexyl-3-morpholin-4-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylate (PubChem CID 11354028) has the molecular formula C37H49N3O5 and a molecular weight of 615.82 g/mol. Its IUPAC name is ethyl 2-benzyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-7-hexyl-3-morpholin-4-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylate.
| Compound Name | ethyl 2-benzyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-7-hexyl-3-morpholin-4-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 11354028 |
| Molecular Formula | C37H49N3O5 |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.37 |
| IUPAC Name | ethyl 2-benzyl-6-[2-(3,4-dimethoxyphenyl)ethyl]-7-hexyl-3-morpholin-4-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylate |
| SMILES | CCCCCCC1c2nc(Cc3ccccc3)c(N3CCOCC3)c(C(=O)OCC)c2CN1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C37H49N3O5/c1-5-7-8-12-15-31-35-29(26-40(31)19-18-28-16-17-32(42-3)33(25-28)43-4)34(37(41)45-6-2)36(39-20-22-44-23-21-39)30(38-35)24-27-13-10-9-11-14-27/h9-11,13-14,16-17,25,31H,5-8,12,15,18-24,26H2,1-4H3 |
| InChIKey | XGAOCCLBJYRILW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|