C34H62O6Si2 — CID 11354084
(4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9,13-pentamethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 11354084) has the molecular formula C34H62O6Si2 and a molecular weight of 623.04 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9,13-pentamethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9,13-pentamethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 11354084 |
| Molecular Formula | C34H62O6Si2 |
| Molecular Weight | 623.04 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | (4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-8-[tert-butyl(dimethyl)silyl]oxy-5,5,7,9,13-pentamethyl-4-triethylsilyloxy-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC(=O)O[C@H](C(C)=O)C/C=C(/C)C/C=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C1(C)C |
| InChI | InChI=1S/C34H62O6Si2/c1-15-42(16-2,17-3)39-29-23-30(36)38-28(27(7)35)22-21-24(4)19-18-20-25(5)31(26(6)32(37)34(29,11)12)40-41(13,14)33(8,9)10/h18,20-21,25-26,28-29,31H,15-17,19,22-23H2,1-14H3/b20-18+,24-21-/t25-,26+,28-,29-,31-/m0/s1 |
| InChIKey | BPJMJCGODGISGH-SJHWKXAQSA-N |
| XLogP | 8.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.04 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|