About 2-(5,5-dimethyloxolan-2-yl)ethanol
2-(5,5-dimethyloxolan-2-yl)ethanol (PubChem CID 11355541) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2-(5,5-dimethyloxolan-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5,5-dimethyloxolan-2-yl)ethanol |
| PubChem CID | 11355541 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2-(5,5-dimethyloxolan-2-yl)ethanol |
| SMILES | CC1(C)CCC(CCO)O1 |
| InChI | InChI=1S/C8H16O2/c1-8(2)5-3-7(10-8)4-6-9/h7,9H,3-6H2,1-2H3 |
| InChIKey | RTCOOAFFLFSWTK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(5,5-dimethyloxolan-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethyloxolan-2-yl)ethanol?
The IUPAC name of 2-(5,5-dimethyloxolan-2-yl)ethanol (CID 11355541) is 2-(5,5-dimethyloxolan-2-yl)ethanol.
What is the SMILES notation for 2-(5,5-dimethyloxolan-2-yl)ethanol?
The canonical SMILES for 2-(5,5-dimethyloxolan-2-yl)ethanol is CC1(C)CCC(CCO)O1.
What is the InChIKey of 2-(5,5-dimethyloxolan-2-yl)ethanol?
The InChIKey is RTCOOAFFLFSWTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-8(2)5-3-7(10-8)4-6-9/h7,9H,3-6H2,1-2H3.
What are the key properties of 2-(5,5-dimethyloxolan-2-yl)ethanol?
2-(5,5-dimethyloxolan-2-yl)ethanol has a molecular weight of 144.21 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethyloxolan-2-yl)ethanol is sourced from PubChem (CID 11355541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).