About [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate
[(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate (PubChem CID 11355718) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate.
Molecular Properties
| Compound Name | [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate |
| PubChem CID | 11355718 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate |
| SMILES | C=C[C@H]1OC(=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C8H10O4/c1-3-6-7(11-5(2)9)4-8(10)12-6/h3,6-7H,1,4H2,2H3/t6-,7-/m1/s1 |
| InChIKey | LTESIRBZUXTXHY-RNFRBKRXSA-N |
| XLogP | 0.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate?
The IUPAC name of [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate (CID 11355718) is [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate.
What is the SMILES notation for [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate?
The canonical SMILES for [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate is C=C[C@H]1OC(=O)C[C@H]1OC(C)=O.
What is the InChIKey of [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate?
The InChIKey is LTESIRBZUXTXHY-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H10O4/c1-3-6-7(11-5(2)9)4-8(10)12-6/h3,6-7H,1,4H2,2H3/t6-,7-/m1/s1.
What are the key properties of [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate?
[(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate has a molecular weight of 170.16 g/mol, XLogP of 0.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2-ethenyl-5-oxooxolan-3-yl] acetate is sourced from PubChem (CID 11355718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).