C8H14O2Si — CID 11355736
(2E)-4-trimethylsilyloxypenta-2,4-dienal (PubChem CID 11355736) has the molecular formula C8H14O2Si and a molecular weight of 170.28 g/mol. Its IUPAC name is (2E)-4-trimethylsilyloxypenta-2,4-dienal.
| Compound Name | (2E)-4-trimethylsilyloxypenta-2,4-dienal |
|---|---|
| PubChem CID | 11355736 |
| Molecular Formula | C8H14O2Si |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (2E)-4-trimethylsilyloxypenta-2,4-dienal |
| SMILES | C=C(/C=C/C=O)O[Si](C)(C)C |
| InChI | InChI=1S/C8H14O2Si/c1-8(6-5-7-9)10-11(2,3)4/h5-7H,1H2,2-4H3/b6-5+ |
| InChIKey | UPEOCOJRJCAIGO-AATRIKPKSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|