About ethyl oxolan-2-ylmethyl carbonate
ethyl oxolan-2-ylmethyl carbonate (PubChem CID 11355777) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is ethyl oxolan-2-ylmethyl carbonate.
Molecular Properties
| Compound Name | ethyl oxolan-2-ylmethyl carbonate |
| PubChem CID | 11355777 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | ethyl oxolan-2-ylmethyl carbonate |
| SMILES | CCOC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C8H14O4/c1-2-10-8(9)12-6-7-4-3-5-11-7/h7H,2-6H2,1H3 |
| InChIKey | HXAMEATVLOHWMZ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl oxolan-2-ylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl oxolan-2-ylmethyl carbonate?
The IUPAC name of ethyl oxolan-2-ylmethyl carbonate (CID 11355777) is ethyl oxolan-2-ylmethyl carbonate.
What is the SMILES notation for ethyl oxolan-2-ylmethyl carbonate?
The canonical SMILES for ethyl oxolan-2-ylmethyl carbonate is CCOC(=O)OCC1CCCO1.
What is the InChIKey of ethyl oxolan-2-ylmethyl carbonate?
The InChIKey is HXAMEATVLOHWMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-2-10-8(9)12-6-7-4-3-5-11-7/h7H,2-6H2,1H3.
What are the key properties of ethyl oxolan-2-ylmethyl carbonate?
ethyl oxolan-2-ylmethyl carbonate has a molecular weight of 174.20 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl oxolan-2-ylmethyl carbonate is sourced from PubChem (CID 11355777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).