C10H11NO2 — CID 11355813
(3aS,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-ol (PubChem CID 11355813) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3aS,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-ol.
| Compound Name | (3aS,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-ol |
|---|---|
| PubChem CID | 11355813 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (3aS,8bR)-1,2,3a,4-tetrahydrofuro[2,3-b]indol-8b-ol |
| SMILES | O[C@@]12CCO[C@@H]1Nc1ccccc12 |
| InChI | InChI=1S/C10H11NO2/c12-10-5-6-13-9(10)11-8-4-2-1-3-7(8)10/h1-4,9,11-12H,5-6H2/t9-,10+/m0/s1 |
| InChIKey | ARMDWESWZUMWSO-VHSXEESVSA-N |
| XLogP | 1.05 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |