4-aminobenzene-1,3-dicarboxylic acid

C8H7NO4 — CID 11355852

IUPAC4-aminobenzene-1,3-dicarboxylic acid
SMILESNc1ccc(C(=O)O)cc1C(=O)O
InChIInChI=1S/C8H7NO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13)
InChIKeyBDBLLWHZWCBDAR-UHFFFAOYSA-N
MW181.15 g/mol
LogP0.67
Rot. Bonds2

About 4-aminobenzene-1,3-dicarboxylic acid

4-aminobenzene-1,3-dicarboxylic acid (PubChem CID 11355852) has the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. Its IUPAC name is 4-aminobenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-aminobenzene-1,3-dicarboxylic acid
PubChem CID11355852
Molecular FormulaC8H7NO4
Molecular Weight181.15 g/mol
Exact Mass181.04
IUPAC Name4-aminobenzene-1,3-dicarboxylic acid
SMILESNc1ccc(C(=O)O)cc1C(=O)O
InChIInChI=1S/C8H7NO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13)
InChIKeyBDBLLWHZWCBDAR-UHFFFAOYSA-N
XLogP0.67
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.15
LogP ≤ 50.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-aminobenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-aminobenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-aminobenzene-1,3-dicarboxylic acid (CID 11355852) is 4-aminobenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-aminobenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-aminobenzene-1,3-dicarboxylic acid is Nc1ccc(C(=O)O)cc1C(=O)O.
What is the InChIKey of 4-aminobenzene-1,3-dicarboxylic acid?
The InChIKey is BDBLLWHZWCBDAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13).
What are the key properties of 4-aminobenzene-1,3-dicarboxylic acid?
4-aminobenzene-1,3-dicarboxylic acid has a molecular weight of 181.15 g/mol, XLogP of 0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 11355852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).