About 2-(2-chlorophenyl)-2,3-dihydrothiophene
2-(2-chlorophenyl)-2,3-dihydrothiophene (PubChem CID 11356052) has the molecular formula C10H9ClS
and a molecular weight of 196.70 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-2,3-dihydrothiophene |
| PubChem CID | 11356052 |
| Molecular Formula | C10H9ClS |
| Molecular Weight | 196.70 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2-(2-chlorophenyl)-2,3-dihydrothiophene |
| SMILES | Clc1ccccc1C1CC=CS1 |
| InChI | InChI=1S/C10H9ClS/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-5,7,10H,6H2 |
| InChIKey | WCGYRTKRAOMYHT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.70 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-chlorophenyl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-2,3-dihydrothiophene?
The IUPAC name of 2-(2-chlorophenyl)-2,3-dihydrothiophene (CID 11356052) is 2-(2-chlorophenyl)-2,3-dihydrothiophene.
What is the SMILES notation for 2-(2-chlorophenyl)-2,3-dihydrothiophene?
The canonical SMILES for 2-(2-chlorophenyl)-2,3-dihydrothiophene is Clc1ccccc1C1CC=CS1.
What is the InChIKey of 2-(2-chlorophenyl)-2,3-dihydrothiophene?
The InChIKey is WCGYRTKRAOMYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClS/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-5,7,10H,6H2.
What are the key properties of 2-(2-chlorophenyl)-2,3-dihydrothiophene?
2-(2-chlorophenyl)-2,3-dihydrothiophene has a molecular weight of 196.70 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-2,3-dihydrothiophene is sourced from PubChem (CID 11356052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).