About 4-bromobenzene-1,2-dicarbonitrile
4-bromobenzene-1,2-dicarbonitrile (PubChem CID 11356223) has the molecular formula C8H3BrN2
and a molecular weight of 207.03 g/mol. Its IUPAC name is 4-bromobenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-bromobenzene-1,2-dicarbonitrile |
| PubChem CID | 11356223 |
| Molecular Formula | C8H3BrN2 |
| Molecular Weight | 207.03 g/mol |
| Exact Mass | 205.95 |
| IUPAC Name | 4-bromobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Br)cc1C#N |
| InChI | InChI=1S/C8H3BrN2/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3H |
| InChIKey | ARAONWRSVQOHIT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.03 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromobenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzene-1,2-dicarbonitrile?
The IUPAC name of 4-bromobenzene-1,2-dicarbonitrile (CID 11356223) is 4-bromobenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-bromobenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-bromobenzene-1,2-dicarbonitrile is N#Cc1ccc(Br)cc1C#N.
What is the InChIKey of 4-bromobenzene-1,2-dicarbonitrile?
The InChIKey is ARAONWRSVQOHIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrN2/c9-8-2-1-6(4-10)7(3-8)5-11/h1-3H.
What are the key properties of 4-bromobenzene-1,2-dicarbonitrile?
4-bromobenzene-1,2-dicarbonitrile has a molecular weight of 207.03 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzene-1,2-dicarbonitrile is sourced from PubChem (CID 11356223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).