C23H22N4O3S — CID 1135678
N-(1,3-benzodioxol-5-ylmethyl)-2-[(4,6,8-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide (PubChem CID 1135678) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(4,6,8-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4,6,8-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 1135678 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(4,6,8-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(C)c2cc(C)c3nnc(SCC(=O)NCc4ccc5c(c4)OCO5)n3c2c1 |
| InChI | InChI=1S/C23H22N4O3S/c1-13-6-14(2)17-8-15(3)22-25-26-23(27(22)18(17)7-13)31-11-21(28)24-10-16-4-5-19-20(9-16)30-12-29-19/h4-9H,10-12H2,1-3H3,(H,24,28) |
| InChIKey | BABCXYYBWFBPBO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |