C18H24 — CID 11356891
1,3,3-trimethyl-2-[(1E,3E,5E)-3-methylocta-1,3,5-trien-7-ynyl]cyclohexene (PubChem CID 11356891) has the molecular formula C18H24 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,3E,5E)-3-methylocta-1,3,5-trien-7-ynyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,3E,5E)-3-methylocta-1,3,5-trien-7-ynyl]cyclohexene |
|---|---|
| PubChem CID | 11356891 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,3E,5E)-3-methylocta-1,3,5-trien-7-ynyl]cyclohexene |
| SMILES | C#C/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H24/c1-6-7-8-10-15(2)12-13-17-16(3)11-9-14-18(17,4)5/h1,7-8,10,12-13H,9,11,14H2,2-5H3/b8-7+,13-12+,15-10+ |
| InChIKey | PMSYGUNXIAPMSN-XUQUSYQGSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|