About benzyl 4-(aminomethyl)benzoate
benzyl 4-(aminomethyl)benzoate (PubChem CID 11356901) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is benzyl 4-(aminomethyl)benzoate.
Molecular Properties
| Compound Name | benzyl 4-(aminomethyl)benzoate |
| PubChem CID | 11356901 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | benzyl 4-(aminomethyl)benzoate |
| SMILES | NCc1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H15NO2/c16-10-12-6-8-14(9-7-12)15(17)18-11-13-4-2-1-3-5-13/h1-9H,10-11,16H2 |
| InChIKey | FCGLCSVHSUTHOE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 4-(aminomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(aminomethyl)benzoate?
The IUPAC name of benzyl 4-(aminomethyl)benzoate (CID 11356901) is benzyl 4-(aminomethyl)benzoate.
What is the SMILES notation for benzyl 4-(aminomethyl)benzoate?
The canonical SMILES for benzyl 4-(aminomethyl)benzoate is NCc1ccc(C(=O)OCc2ccccc2)cc1.
What is the InChIKey of benzyl 4-(aminomethyl)benzoate?
The InChIKey is FCGLCSVHSUTHOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c16-10-12-6-8-14(9-7-12)15(17)18-11-13-4-2-1-3-5-13/h1-9H,10-11,16H2.
What are the key properties of benzyl 4-(aminomethyl)benzoate?
benzyl 4-(aminomethyl)benzoate has a molecular weight of 241.29 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(aminomethyl)benzoate is sourced from PubChem (CID 11356901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).