About [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate
[(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate (PubChem CID 11357102) has the molecular formula C10H16O3S2
and a molecular weight of 248.37 g/mol. Its IUPAC name is [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate |
| PubChem CID | 11357102 |
| Molecular Formula | C10H16O3S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](CC1SCCCS1)C(C)=O |
| InChI | InChI=1S/C10H16O3S2/c1-7(11)9(13-8(2)12)6-10-14-4-3-5-15-10/h9-10H,3-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | RQPLLWJWEFUPMK-VIFPVBQESA-N |
| XLogP | 2.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate?
The IUPAC name of [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate (CID 11357102) is [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate.
What is the SMILES notation for [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate?
The canonical SMILES for [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate is CC(=O)O[C@@H](CC1SCCCS1)C(C)=O.
What is the InChIKey of [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate?
The InChIKey is RQPLLWJWEFUPMK-VIFPVBQESA-N. The full InChI is InChI=1S/C10H16O3S2/c1-7(11)9(13-8(2)12)6-10-14-4-3-5-15-10/h9-10H,3-6H2,1-2H3/t9-/m0/s1.
What are the key properties of [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate?
[(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate has a molecular weight of 248.37 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(1,3-dithian-2-yl)-3-oxobutan-2-yl] acetate is sourced from PubChem (CID 11357102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).