C13H18O5 — CID 11357243
(2E,4E,6E,8R,9S)-8-hydroxy-3,7,9-trimethyldeca-2,4,6-trienedioic acid (PubChem CID 11357243) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (2E,4E,6E,8R,9S)-8-hydroxy-3,7,9-trimethyldeca-2,4,6-trienedioic acid.
| Compound Name | (2E,4E,6E,8R,9S)-8-hydroxy-3,7,9-trimethyldeca-2,4,6-trienedioic acid |
|---|---|
| PubChem CID | 11357243 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (2E,4E,6E,8R,9S)-8-hydroxy-3,7,9-trimethyldeca-2,4,6-trienedioic acid |
| SMILES | CC(/C=C/C=C(\C)[C@H](O)[C@H](C)C(=O)O)=C\C(=O)O |
| InChI | InChI=1S/C13H18O5/c1-8(7-11(14)15)5-4-6-9(2)12(16)10(3)13(17)18/h4-7,10,12,16H,1-3H3,(H,14,15)(H,17,18)/b5-4+,8-7+,9-6+/t10-,12-/m0/s1 |
| InChIKey | GQDNQARAYQKEDE-ITMZQLLZSA-N |
| XLogP | 1.60 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|