C14H22O2S — CID 11357263
(2R,4R)-2-tert-butyl-4-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-1,3-oxathiolan-5-one (PubChem CID 11357263) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-4-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-1,3-oxathiolan-5-one.
| Compound Name | (2R,4R)-2-tert-butyl-4-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 11357263 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2R,4R)-2-tert-butyl-4-[(1E,3E)-hexa-1,3-dienyl]-4-methyl-1,3-oxathiolan-5-one |
| SMILES | CC/C=C/C=C/[C@@]1(C)S[C@H](C(C)(C)C)OC1=O |
| InChI | InChI=1S/C14H22O2S/c1-6-7-8-9-10-14(5)11(15)16-12(17-14)13(2,3)4/h7-10,12H,6H2,1-5H3/b8-7+,10-9+/t12-,14-/m1/s1 |
| InChIKey | CCWIHHSGNAQKQR-FJADVZLUSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|