C16H20O3 — CID 11357424
3,3-dimethyl-4,6,7,8,9,10-hexahydro-2H-cyclohepta[b]chromene-1,11-dione (PubChem CID 11357424) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 3,3-dimethyl-4,6,7,8,9,10-hexahydro-2H-cyclohepta[b]chromene-1,11-dione.
| Compound Name | 3,3-dimethyl-4,6,7,8,9,10-hexahydro-2H-cyclohepta[b]chromene-1,11-dione |
|---|---|
| PubChem CID | 11357424 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3,3-dimethyl-4,6,7,8,9,10-hexahydro-2H-cyclohepta[b]chromene-1,11-dione |
| SMILES | CC1(C)CC(=O)c2c(oc3c(c2=O)CCCCC3)C1 |
| InChI | InChI=1S/C16H20O3/c1-16(2)8-11(17)14-13(9-16)19-12-7-5-3-4-6-10(12)15(14)18/h3-9H2,1-2H3 |
| InChIKey | UUEPYLSMPXCPEY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |