About Lansiumamide B
Lansiumamide B (PubChem CID 11357517) has the molecular formula C18H17NO
and a molecular weight of 263.30 g/mol. Its IUPAC name is (E)-N-methyl-3-phenyl-N-[(Z)-2-phenylethenyl]prop-2-enamide.
Molecular Properties
| Compound Name | Lansiumamide B |
| PubChem CID | 11357517 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (E)-N-methyl-3-phenyl-N-[(Z)-2-phenylethenyl]prop-2-enamide |
| SMILES | CN(/C=C\C1=CC=CC=C1)C(=O)/C=C/C2=CC=CC=C2 |
| InChI | InChI=1S/C18H17NO/c1-19(15-14-17-10-6-3-7-11-17)18(20)13-12-16-8-4-2-5-9-16/h2-15H,1H3/b13-12+,15-14- |
| InChIKey | VJGRWRRIAJQNFU-NQDQBVNISA-N |
| XLogP | 3.80 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 346 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze Lansiumamide B with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lansiumamide B?
The IUPAC name of Lansiumamide B (CID 11357517) is (E)-N-methyl-3-phenyl-N-[(Z)-2-phenylethenyl]prop-2-enamide.
What is the SMILES notation for Lansiumamide B?
The canonical SMILES for Lansiumamide B is CN(/C=C\C1=CC=CC=C1)C(=O)/C=C/C2=CC=CC=C2.
What is the InChIKey of Lansiumamide B?
The InChIKey is VJGRWRRIAJQNFU-NQDQBVNISA-N. The full InChI is InChI=1S/C18H17NO/c1-19(15-14-17-10-6-3-7-11-17)18(20)13-12-16-8-4-2-5-9-16/h2-15H,1H3/b13-12+,15-14-.
What are the key properties of Lansiumamide B?
Lansiumamide B has a molecular weight of 263.30 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Lansiumamide B is sourced from PubChem (CID 11357517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).