C15H20O4 — CID 11357536
(4aR,5S,8R,9aR)-8,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one (PubChem CID 11357536) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (4aR,5S,8R,9aR)-8,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one.
| Compound Name | (4aR,5S,8R,9aR)-8,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11357536 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (4aR,5S,8R,9aR)-8,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2C[C@@]3(C)C(=C[C@@]2(O)OC1=O)[C@H](O)CC[C@@H]3C |
| InChI | InChI=1S/C15H20O4/c1-8-4-5-12(16)11-7-15(18)10(6-14(8,11)3)9(2)13(17)19-15/h7-8,12,16,18H,4-6H2,1-3H3/t8-,12+,14+,15+/m0/s1 |
| InChIKey | ILDMSNFGPQLCNL-AZEZGGBOSA-N |
| XLogP | 1.68 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|