C16H26O3 — CID 11357612
(4aR,7S,8S,8aS)-8-[(3R)-3,5-dihydroxypentyl]-7-methyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one (PubChem CID 11357612) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (4aR,7S,8S,8aS)-8-[(3R)-3,5-dihydroxypentyl]-7-methyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aR,7S,8S,8aS)-8-[(3R)-3,5-dihydroxypentyl]-7-methyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 11357612 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (4aR,7S,8S,8aS)-8-[(3R)-3,5-dihydroxypentyl]-7-methyl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-one |
| SMILES | C[C@H]1C=C[C@H]2CCCC(=O)[C@@H]2[C@H]1CC[C@@H](O)CCO |
| InChI | InChI=1S/C16H26O3/c1-11-5-6-12-3-2-4-15(19)16(12)14(11)8-7-13(18)9-10-17/h5-6,11-14,16-18H,2-4,7-10H2,1H3/t11-,12+,13+,14-,16-/m0/s1 |
| InChIKey | UPRRWWISCIZIDJ-ADVQIIOHSA-N |
| XLogP | 2.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|