About N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide
N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide (PubChem CID 11357631) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide |
| PubChem CID | 11357631 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide |
| SMILES | C=C[C@H](O)[C@@H](NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c1-2-15(19)16(13-9-5-3-6-10-13)18-17(20)14-11-7-4-8-12-14/h2-12,15-16,19H,1H2,(H,18,20)/t15-,16-/m0/s1 |
| InChIKey | OQLKLXPKPPPXDZ-HOTGVXAUSA-N |
| XLogP | 2.70 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide?
The IUPAC name of N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide (CID 11357631) is N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide.
What is the SMILES notation for N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide?
The canonical SMILES for N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide is C=C[C@H](O)[C@@H](NC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide?
The InChIKey is OQLKLXPKPPPXDZ-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H17NO2/c1-2-15(19)16(13-9-5-3-6-10-13)18-17(20)14-11-7-4-8-12-14/h2-12,15-16,19H,1H2,(H,18,20)/t15-,16-/m0/s1.
What are the key properties of N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide?
N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide has a molecular weight of 267.33 g/mol, XLogP of 2.70, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-2-hydroxy-1-phenylbut-3-enyl]benzamide is sourced from PubChem (CID 11357631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).