C15H24O4 — CID 11357666
(3S,3aS,6S,7R,10E,11aS)-6,7-dihydroxy-3,6,10-trimethyl-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-2-one (PubChem CID 11357666) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (3S,3aS,6S,7R,10E,11aS)-6,7-dihydroxy-3,6,10-trimethyl-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-2-one.
| Compound Name | (3S,3aS,6S,7R,10E,11aS)-6,7-dihydroxy-3,6,10-trimethyl-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 11357666 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (3S,3aS,6S,7R,10E,11aS)-6,7-dihydroxy-3,6,10-trimethyl-3,3a,4,5,7,8,9,11a-octahydrocyclodeca[b]furan-2-one |
| SMILES | C/C1=C\[C@H]2OC(=O)[C@@H](C)[C@@H]2CC[C@](C)(O)[C@H](O)CC1 |
| InChI | InChI=1S/C15H24O4/c1-9-4-5-13(16)15(3,18)7-6-11-10(2)14(17)19-12(11)8-9/h8,10-13,16,18H,4-7H2,1-3H3/b9-8+/t10-,11-,12+,13+,15-/m0/s1 |
| InChIKey | QOSIOUROGGBFCM-SLKIWDFXSA-N |
| XLogP | 1.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|