About 1-(4-phenylphenyl)hexane-1,6-diol
1-(4-phenylphenyl)hexane-1,6-diol (PubChem CID 11357716) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-(4-phenylphenyl)hexane-1,6-diol.
Molecular Properties
| Compound Name | 1-(4-phenylphenyl)hexane-1,6-diol |
| PubChem CID | 11357716 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(4-phenylphenyl)hexane-1,6-diol |
| SMILES | OCCCCCC(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22O2/c19-14-6-2-5-9-18(20)17-12-10-16(11-13-17)15-7-3-1-4-8-15/h1,3-4,7-8,10-13,18-20H,2,5-6,9,14H2 |
| InChIKey | GDAADMSMITZOCO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-phenylphenyl)hexane-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-phenylphenyl)hexane-1,6-diol?
The IUPAC name of 1-(4-phenylphenyl)hexane-1,6-diol (CID 11357716) is 1-(4-phenylphenyl)hexane-1,6-diol.
What is the SMILES notation for 1-(4-phenylphenyl)hexane-1,6-diol?
The canonical SMILES for 1-(4-phenylphenyl)hexane-1,6-diol is OCCCCCC(O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-(4-phenylphenyl)hexane-1,6-diol?
The InChIKey is GDAADMSMITZOCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c19-14-6-2-5-9-18(20)17-12-10-16(11-13-17)15-7-3-1-4-8-15/h1,3-4,7-8,10-13,18-20H,2,5-6,9,14H2.
What are the key properties of 1-(4-phenylphenyl)hexane-1,6-diol?
1-(4-phenylphenyl)hexane-1,6-diol has a molecular weight of 270.37 g/mol, XLogP of 3.94, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-phenylphenyl)hexane-1,6-diol is sourced from PubChem (CID 11357716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).