About bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile
bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile (PubChem CID 11357730) has the molecular formula C13H26BNO4
and a molecular weight of 271.17 g/mol. Its IUPAC name is bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile.
Molecular Properties
| Compound Name | bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile |
| PubChem CID | 11357730 |
| Molecular Formula | C13H26BNO4 |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile |
| SMILES | CC(C)(O)C(C)(C)OB(C#N)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H26BNO4/c1-10(2,16)12(5,6)18-14(9-15)19-13(7,8)11(3,4)17/h16-17H,1-8H3 |
| InChIKey | GOULFOQDNODJPB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile?
The IUPAC name of bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile (CID 11357730) is bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile.
What is the SMILES notation for bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile?
The canonical SMILES for bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile is CC(C)(O)C(C)(C)OB(C#N)OC(C)(C)C(C)(C)O.
What is the InChIKey of bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile?
The InChIKey is GOULFOQDNODJPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26BNO4/c1-10(2,16)12(5,6)18-14(9-15)19-13(7,8)11(3,4)17/h16-17H,1-8H3.
What are the key properties of bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile?
bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile has a molecular weight of 271.17 g/mol, XLogP of 1.67, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy]boranylformonitrile is sourced from PubChem (CID 11357730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).