About dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate
dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 11358058) has the molecular formula C13H21NO4Si
and a molecular weight of 283.40 g/mol. Its IUPAC name is dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 11358058 |
| Molecular Formula | C13H21NO4Si |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C#C[Si](C)(C)C)N1C(=O)OC |
| InChI | InChI=1S/C13H21NO4Si/c1-17-12(15)11-7-6-10(8-9-19(3,4)5)14(11)13(16)18-2/h10-11H,6-7H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | ZNCCPTZQWVXNMT-QWRGUYRKSA-N |
| XLogP | 1.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate?
The IUPAC name of dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate (CID 11358058) is dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate is COC(=O)[C@@H]1CC[C@@H](C#C[Si](C)(C)C)N1C(=O)OC.
What is the InChIKey of dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate?
The InChIKey is ZNCCPTZQWVXNMT-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H21NO4Si/c1-17-12(15)11-7-6-10(8-9-19(3,4)5)14(11)13(16)18-2/h10-11H,6-7H2,1-5H3/t10-,11-/m0/s1.
What are the key properties of dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate?
dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate has a molecular weight of 283.40 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2S,5S)-5-(2-trimethylsilylethynyl)pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 11358058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).