About tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane
tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane (PubChem CID 11358206) has the molecular formula C14H25ClO2Si
and a molecular weight of 288.89 g/mol. Its IUPAC name is tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane |
| PubChem CID | 11358206 |
| Molecular Formula | C14H25ClO2Si |
| Molecular Weight | 288.89 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@]12C=CC(Cl)O2 |
| InChI | InChI=1S/C14H25ClO2Si/c1-13(2,3)18(4,5)17-11-7-6-9-14(11)10-8-12(15)16-14/h8,10-12H,6-7,9H2,1-5H3/t11-,12?,14+/m1/s1 |
| InChIKey | GCNBIDIRJGWLMF-SOGVLRHJSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.89 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane?
The IUPAC name of tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane (CID 11358206) is tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane.
What is the SMILES notation for tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane?
The canonical SMILES for tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane is CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@]12C=CC(Cl)O2.
What is the InChIKey of tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane?
The InChIKey is GCNBIDIRJGWLMF-SOGVLRHJSA-N. The full InChI is InChI=1S/C14H25ClO2Si/c1-13(2,3)18(4,5)17-11-7-6-9-14(11)10-8-12(15)16-14/h8,10-12H,6-7,9H2,1-5H3/t11-,12?,14+/m1/s1.
What are the key properties of tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane?
tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane has a molecular weight of 288.89 g/mol, XLogP of 4.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[[(5S,9R)-2-chloro-1-oxaspiro[4.4]non-3-en-9-yl]oxy]-dimethylsilane is sourced from PubChem (CID 11358206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).