C15H28O4Si — CID 11358509
(1R,3S,5R,8R,10S)-6-methyl-6-trimethylsilyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol (PubChem CID 11358509) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (1R,3S,5R,8R,10S)-6-methyl-6-trimethylsilyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol.
| Compound Name | (1R,3S,5R,8R,10S)-6-methyl-6-trimethylsilyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol |
|---|---|
| PubChem CID | 11358509 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (1R,3S,5R,8R,10S)-6-methyl-6-trimethylsilyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-ol |
| SMILES | CC1([Si](C)(C)C)O[C@@H]2C[C@@H]3OCCC[C@H]3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C15H28O4Si/c1-15(20(2,3)4)14(16)9-12-13(19-15)8-11-10(18-12)6-5-7-17-11/h10-14,16H,5-9H2,1-4H3/t10-,11+,12+,13-,14-,15?/m1/s1 |
| InChIKey | WEBSMRSEYCROFT-VGSCMHHQSA-N |
| XLogP | 2.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|