C16H20N2O4 — CID 11358608
ethyl 3-(5-ethoxycarbonyl-4-methyl-1H-pyrrol-3-yl)-4-methyl-1H-pyrrole-2-carboxylate (PubChem CID 11358608) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is ethyl 3-(5-ethoxycarbonyl-4-methyl-1H-pyrrol-3-yl)-4-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-(5-ethoxycarbonyl-4-methyl-1H-pyrrol-3-yl)-4-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 11358608 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | ethyl 3-(5-ethoxycarbonyl-4-methyl-1H-pyrrol-3-yl)-4-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc(-c2c(C)c[nH]c2C(=O)OCC)c1C |
| InChI | InChI=1S/C16H20N2O4/c1-5-21-15(19)13-10(4)11(8-18-13)12-9(3)7-17-14(12)16(20)22-6-2/h7-8,17-18H,5-6H2,1-4H3 |
| InChIKey | KLUSTMDYWIRSCS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |