C20H21NO2 — CID 11358726
(4R)-3-[(Z,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 11358726) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (4R)-3-[(Z,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(Z,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11358726 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (4R)-3-[(Z,3S)-2,3-diphenylbut-1-enyl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H](/C(=C/N1C(=O)OC[C@H]1C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO2/c1-15-14-23-20(22)21(15)13-19(18-11-7-4-8-12-18)16(2)17-9-5-3-6-10-17/h3-13,15-16H,14H2,1-2H3/b19-13-/t15-,16+/m1/s1 |
| InChIKey | DZWCFBODDJXTSH-CKCVYMDASA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |