C22H19NO — CID 11358902
N-[(E)-1,3-diphenylprop-2-enyl]-1-phenylmethanimine oxide (PubChem CID 11358902) has the molecular formula C22H19NO and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(E)-1,3-diphenylprop-2-enyl]-1-phenylmethanimine oxide.
| Compound Name | N-[(E)-1,3-diphenylprop-2-enyl]-1-phenylmethanimine oxide |
|---|---|
| PubChem CID | 11358902 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-[(E)-1,3-diphenylprop-2-enyl]-1-phenylmethanimine oxide |
| SMILES | [O-]/[N+](=C\c1ccccc1)C(/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO/c24-23(18-20-12-6-2-7-13-20)22(21-14-8-3-9-15-21)17-16-19-10-4-1-5-11-19/h1-18,22H/b17-16+,23-18- |
| InChIKey | AZDMFHYVHFPBFM-AJIOFTKLSA-N |
| XLogP | 5.07 |
| TPSA | 26.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|