About N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide
N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide (PubChem CID 11358940) has the molecular formula C11H10N2O3S3
and a molecular weight of 314.41 g/mol. Its IUPAC name is N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide.
Molecular Properties
| Compound Name | N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide |
| PubChem CID | 11358940 |
| Molecular Formula | C11H10N2O3S3 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide |
| SMILES | O=C(CS)c1ccc(NS(=O)(=O)c2nccs2)cc1 |
| InChI | InChI=1S/C11H10N2O3S3/c14-10(7-17)8-1-3-9(4-2-8)13-19(15,16)11-12-5-6-18-11/h1-6,13,17H,7H2 |
| InChIKey | ZNOURSICQAHUIF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide?
The IUPAC name of N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide (CID 11358940) is N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide.
What is the SMILES notation for N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide?
The canonical SMILES for N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide is O=C(CS)c1ccc(NS(=O)(=O)c2nccs2)cc1.
What is the InChIKey of N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide?
The InChIKey is ZNOURSICQAHUIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3S3/c14-10(7-17)8-1-3-9(4-2-8)13-19(15,16)11-12-5-6-18-11/h1-6,13,17H,7H2.
What are the key properties of N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide?
N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide has a molecular weight of 314.41 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-sulfanylacetyl)phenyl]-1,3-thiazole-2-sulfonamide is sourced from PubChem (CID 11358940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).