C18H29NO4 — CID 11359202
2-[(3aS,4S,7S,7aR)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]-N,N-dimethylacetamide (PubChem CID 11359202) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 2-[(3aS,4S,7S,7aR)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3aS,4S,7S,7aR)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 11359202 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-[(3aS,4S,7S,7aR)-4-prop-2-enylspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-yl]-N,N-dimethylacetamide |
| SMILES | C=CC[C@@H]1OC[C@H](CC(=O)N(C)C)[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C18H29NO4/c1-4-8-14-17-16(13(12-21-14)11-15(20)19(2)3)22-18(23-17)9-6-5-7-10-18/h4,13-14,16-17H,1,5-12H2,2-3H3/t13-,14-,16+,17-/m0/s1 |
| InChIKey | YRBFGXUQFUZXKH-DIECFANBSA-N |
| XLogP | 2.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|