About 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane
3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane (PubChem CID 11359266) has the molecular formula C15H14Cl2N2S
and a molecular weight of 325.26 g/mol. Its IUPAC name is 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane.
Molecular Properties
| Compound Name | 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane |
| PubChem CID | 11359266 |
| Molecular Formula | C15H14Cl2N2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane |
| SMILES | Clc1ccc(N2CSCN(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C15H14Cl2N2S/c16-12-1-5-14(6-2-12)18-9-19(11-20-10-18)15-7-3-13(17)4-8-15/h1-8H,9-11H2 |
| InChIKey | FLQLALSXULOYCO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane?
The IUPAC name of 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane (CID 11359266) is 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane.
What is the SMILES notation for 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane?
The canonical SMILES for 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane is Clc1ccc(N2CSCN(c3ccc(Cl)cc3)C2)cc1.
What is the InChIKey of 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane?
The InChIKey is FLQLALSXULOYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N2S/c16-12-1-5-14(6-2-12)18-9-19(11-20-10-18)15-7-3-13(17)4-8-15/h1-8H,9-11H2.
What are the key properties of 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane?
3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane has a molecular weight of 325.26 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(4-chlorophenyl)-1,3,5-thiadiazinane is sourced from PubChem (CID 11359266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).