C16H32O3Si2 — CID 11359388
trimethyl-[[(1S,5S,6R,7R)-1,5,7-trimethyl-2-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-2-en-6-yl]oxy]silane (PubChem CID 11359388) has the molecular formula C16H32O3Si2 and a molecular weight of 328.60 g/mol. Its IUPAC name is trimethyl-[[(1S,5S,6R,7R)-1,5,7-trimethyl-2-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-2-en-6-yl]oxy]silane.
| Compound Name | trimethyl-[[(1S,5S,6R,7R)-1,5,7-trimethyl-2-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-2-en-6-yl]oxy]silane |
|---|---|
| PubChem CID | 11359388 |
| Molecular Formula | C16H32O3Si2 |
| Molecular Weight | 328.60 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | trimethyl-[[(1S,5S,6R,7R)-1,5,7-trimethyl-2-trimethylsilyloxy-8-oxabicyclo[3.2.1]oct-2-en-6-yl]oxy]silane |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C)[C@]2(C)CC=C(O[Si](C)(C)C)[C@@]1(C)O2 |
| InChI | InChI=1S/C16H32O3Si2/c1-12-14(18-21(7,8)9)15(2)11-10-13(16(12,3)19-15)17-20(4,5)6/h10,12,14H,11H2,1-9H3/t12-,14-,15+,16+/m1/s1 |
| InChIKey | RAJBEPOJJUEEGJ-OJLVUWQFSA-N |
| XLogP | 4.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|