About 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide
2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide (PubChem CID 11359389) has the molecular formula C16H9ClN2O4
and a molecular weight of 328.71 g/mol. Its IUPAC name is 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide.
Molecular Properties
| Compound Name | 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide |
| PubChem CID | 11359389 |
| Molecular Formula | C16H9ClN2O4 |
| Molecular Weight | 328.71 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide |
| SMILES | NC(=O)c1ccc(C(=O)c2ccc3c(c2)C(=O)C(=O)N3)cc1Cl |
| InChI | InChI=1S/C16H9ClN2O4/c17-11-6-8(1-3-9(11)15(18)22)13(20)7-2-4-12-10(5-7)14(21)16(23)19-12/h1-6H,(H2,18,22)(H,19,21,23) |
| InChIKey | KOMLBXZUKKXGQY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.71 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide?
The IUPAC name of 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide (CID 11359389) is 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide.
What is the SMILES notation for 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide?
The canonical SMILES for 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide is NC(=O)c1ccc(C(=O)c2ccc3c(c2)C(=O)C(=O)N3)cc1Cl.
What is the InChIKey of 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide?
The InChIKey is KOMLBXZUKKXGQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClN2O4/c17-11-6-8(1-3-9(11)15(18)22)13(20)7-2-4-12-10(5-7)14(21)16(23)19-12/h1-6H,(H2,18,22)(H,19,21,23).
What are the key properties of 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide?
2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide has a molecular weight of 328.71 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(2,3-dioxo-1H-indole-5-carbonyl)benzamide is sourced from PubChem (CID 11359389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).