C14H17BrO4 — CID 11359395
(2R,4aS)-8-bromo-2-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione (PubChem CID 11359395) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is (2R,4aS)-8-bromo-2-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione.
| Compound Name | (2R,4aS)-8-bromo-2-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
|---|---|
| PubChem CID | 11359395 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (2R,4aS)-8-bromo-2-methyl-4a-(3-methylbutyl)-1,4-benzodioxine-3,7-dione |
| SMILES | CC(C)CC[C@]12C=CC(=O)C(Br)=C1O[C@H](C)C(=O)O2 |
| InChI | InChI=1S/C14H17BrO4/c1-8(2)4-6-14-7-5-10(16)11(15)12(14)18-9(3)13(17)19-14/h5,7-9H,4,6H2,1-3H3/t9-,14+/m1/s1 |
| InChIKey | HAPWDILQIGRVAC-OTYXRUKQSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|