About S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate
S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate (PubChem CID 11359470) has the molecular formula C17H18NO2PS
and a molecular weight of 331.38 g/mol. Its IUPAC name is S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate.
Molecular Properties
| Compound Name | S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate |
| PubChem CID | 11359470 |
| Molecular Formula | C17H18NO2PS |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate |
| SMILES | CC(=O)NCC(=O)SCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18NO2PS/c1-14(19)18-12-17(20)22-13-21(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3,(H,18,19) |
| InChIKey | OOYLQGSQILCJKL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate?
The IUPAC name of S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate (CID 11359470) is S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate.
What is the SMILES notation for S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate?
The canonical SMILES for S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate is CC(=O)NCC(=O)SCP(c1ccccc1)c1ccccc1.
What is the InChIKey of S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate?
The InChIKey is OOYLQGSQILCJKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18NO2PS/c1-14(19)18-12-17(20)22-13-21(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11H,12-13H2,1H3,(H,18,19).
What are the key properties of S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate?
S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate has a molecular weight of 331.38 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(diphenylphosphanylmethyl) 2-acetamidoethanethioate is sourced from PubChem (CID 11359470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).