C16H18FNO4S — CID 11359728
(1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid (PubChem CID 11359728) has the molecular formula C16H18FNO4S and a molecular weight of 339.39 g/mol. Its IUPAC name is (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid.
| Compound Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11359728 |
| Molecular Formula | C16H18FNO4S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-(1-phenylethylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
| SMILES | CC(S[C@@H]1C[C@@H]2[C@H]([C@]1(N)C(=O)O)[C@@]2(F)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H18FNO4S/c1-8(9-5-3-2-4-6-9)23-11-7-10-12(15(10,17)13(19)20)16(11,18)14(21)22/h2-6,8,10-12H,7,18H2,1H3,(H,19,20)(H,21,22)/t8?,10-,11-,12+,15-,16+/m1/s1 |
| InChIKey | YWNJVZBCIQMKMI-WIKHMPDCSA-N |
| XLogP | 2.07 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |