C19H25NO5 — CID 11359993
(2R,4aR,5S)-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one (PubChem CID 11359993) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (2R,4aR,5S)-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one.
| Compound Name | (2R,4aR,5S)-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one |
|---|---|
| PubChem CID | 11359993 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2R,4aR,5S)-2-[2-(methoxymethoxy)ethyl]-5-phenylmethoxy-4a,5,6,7-tetrahydro-2H-pyrido[1,2-b]oxazin-8-one |
| SMILES | COCOCC[C@@H]1C=C[C@@H]2[C@@H](OCc3ccccc3)CCC(=O)N2O1 |
| InChI | InChI=1S/C19H25NO5/c1-22-14-23-12-11-16-7-8-17-18(9-10-19(21)20(17)25-16)24-13-15-5-3-2-4-6-15/h2-8,16-18H,9-14H2,1H3/t16-,17+,18-/m0/s1 |
| InChIKey | QVHYIXVMYSXEAW-KSZLIROESA-N |
| XLogP | 2.44 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|