About (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine
(3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine (PubChem CID 11360133) has the molecular formula C18H14BrN3
and a molecular weight of 352.24 g/mol. Its IUPAC name is (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine.
Molecular Properties
| Compound Name | (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine |
| PubChem CID | 11360133 |
| Molecular Formula | C18H14BrN3 |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine |
| SMILES | [H]/N=c1\c2ccccc2nc2n1CC/C2=C\c1ccccc1Br |
| InChI | InChI=1S/C18H14BrN3/c19-15-7-3-1-5-12(15)11-13-9-10-22-17(20)14-6-2-4-8-16(14)21-18(13)22/h1-8,11,20H,9-10H2/b13-11+,20-17+ |
| InChIKey | OESFMASRZIGVME-JKSGFAINSA-N |
| XLogP | 4.22 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine?
The IUPAC name of (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine (CID 11360133) is (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine.
What is the SMILES notation for (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine?
The canonical SMILES for (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine is [H]/N=c1\c2ccccc2nc2n1CC/C2=C\c1ccccc1Br.
What is the InChIKey of (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine?
The InChIKey is OESFMASRZIGVME-JKSGFAINSA-N. The full InChI is InChI=1S/C18H14BrN3/c19-15-7-3-1-5-12(15)11-13-9-10-22-17(20)14-6-2-4-8-16(14)21-18(13)22/h1-8,11,20H,9-10H2/b13-11+,20-17+.
What are the key properties of (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine?
(3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine has a molecular weight of 352.24 g/mol, XLogP of 4.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-[(2-bromophenyl)methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-imine is sourced from PubChem (CID 11360133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).