C21H26N2O3 — CID 11360208
(1S,5R,7R)-4-[(2S,3R)-2,3-dimethyloxirane-2-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one (PubChem CID 11360208) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is (1S,5R,7R)-4-[(2S,3R)-2,3-dimethyloxirane-2-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one.
| Compound Name | (1S,5R,7R)-4-[(2S,3R)-2,3-dimethyloxirane-2-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
|---|---|
| PubChem CID | 11360208 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (1S,5R,7R)-4-[(2S,3R)-2,3-dimethyloxirane-2-carbonyl]-10,10-dimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-2-one |
| SMILES | C[C@H]1O[C@]1(C)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(C(=O)N1c1ccccc1)C3(C)C |
| InChI | InChI=1S/C21H26N2O3/c1-13-20(4,26-13)17(24)23-16-12-14-10-11-21(16,19(14,2)3)18(25)22(23)15-8-6-5-7-9-15/h5-9,13-14,16H,10-12H2,1-4H3/t13-,14-,16-,20+,21+/m1/s1 |
| InChIKey | ADAWXELDBXVPQD-LRTPJRCMSA-N |
| XLogP | 3.15 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|