C18H38O3Si2 — CID 11360351
(2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-ol (PubChem CID 11360351) has the molecular formula C18H38O3Si2 and a molecular weight of 358.67 g/mol. Its IUPAC name is (2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-ol.
| Compound Name | (2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-ol |
|---|---|
| PubChem CID | 11360351 |
| Molecular Formula | C18H38O3Si2 |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (2R,3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]hex-5-yn-2-ol |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C18H38O3Si2/c1-13-15(20-22(9,10)17(3,4)5)16(14(2)19)21-23(11,12)18(6,7)8/h1,14-16,19H,2-12H3/t14-,15+,16-/m1/s1 |
| InChIKey | LFWYTURWRFOOSL-OWCLPIDISA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|